C18H21N4O6S+ — CID 57073392
(4S,5R,6S)-3-[[3-[2-(hydroxyamino)-2-oxoethyl]imidazo[5,1-b][1,3]thiazol-6-ium-6-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 57073392) has the molecular formula C18H21N4O6S+ and a molecular weight of 421.46 g/mol. Its IUPAC name is (4S,5R,6S)-3-[[3-[2-(hydroxyamino)-2-oxoethyl]imidazo[5,1-b][1,3]thiazol-6-ium-6-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4S,5R,6S)-3-[[3-[2-(hydroxyamino)-2-oxoethyl]imidazo[5,1-b][1,3]thiazol-6-ium-6-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57073392 |
| Molecular Formula | C18H21N4O6S+ |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (4S,5R,6S)-3-[[3-[2-(hydroxyamino)-2-oxoethyl]imidazo[5,1-b][1,3]thiazol-6-ium-6-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(C[n+]3cc4scc(CC(=O)NO)n4c3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C18H20N4O6S/c1-8-11(16(18(26)27)22-15(8)14(9(2)23)17(22)25)4-20-5-13-21(7-20)10(6-29-13)3-12(24)19-28/h5-9,14-15,23H,3-4H2,1-2H3,(H2-,19,24,26,27,28)/p+1/t8-,9+,14+,15+/m0/s1 |
| InChIKey | VOVDJCAYHFAQJJ-MAUFJKMRSA-O |
| XLogP | -0.47 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|