C7H13N3S — CID 57073754
2-(ethylamino)-1-(1H-imidazol-2-yl)ethanethiol (PubChem CID 57073754) has the molecular formula C7H13N3S and a molecular weight of 171.27 g/mol. Its IUPAC name is 2-(ethylamino)-1-(1H-imidazol-2-yl)ethanethiol.
| Compound Name | 2-(ethylamino)-1-(1H-imidazol-2-yl)ethanethiol |
|---|---|
| PubChem CID | 57073754 |
| Molecular Formula | C7H13N3S |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2-(ethylamino)-1-(1H-imidazol-2-yl)ethanethiol |
| SMILES | CCNCC(S)c1ncc[nH]1 |
| InChI | InChI=1S/C7H13N3S/c1-2-8-5-6(11)7-9-3-4-10-7/h3-4,6,8,11H,2,5H2,1H3,(H,9,10) |
| InChIKey | VHUFEAIJPMJRGB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|