C21H22O5 — CID 57073766
(10S,13S,14R,17S)-17-(2-hydroxyacetyl)-10,13-dimethyl-14,15,16,17-tetrahydro-12H-cyclopenta[a]phenanthrene-1,3,11-trione (PubChem CID 57073766) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is (10S,13S,14R,17S)-17-(2-hydroxyacetyl)-10,13-dimethyl-14,15,16,17-tetrahydro-12H-cyclopenta[a]phenanthrene-1,3,11-trione.
| Compound Name | (10S,13S,14R,17S)-17-(2-hydroxyacetyl)-10,13-dimethyl-14,15,16,17-tetrahydro-12H-cyclopenta[a]phenanthrene-1,3,11-trione |
|---|---|
| PubChem CID | 57073766 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (10S,13S,14R,17S)-17-(2-hydroxyacetyl)-10,13-dimethyl-14,15,16,17-tetrahydro-12H-cyclopenta[a]phenanthrene-1,3,11-trione |
| SMILES | C[C@]12C(=O)CC(=O)C=C1C=CC1=C2C(=O)C[C@]2(C)[C@@H](C(=O)CO)CC[C@@H]12 |
| InChI | InChI=1S/C21H22O5/c1-20-9-16(24)19-13(14(20)5-6-15(20)17(25)10-22)4-3-11-7-12(23)8-18(26)21(11,19)2/h3-4,7,14-15,22H,5-6,8-10H2,1-2H3/t14-,15+,20-,21+/m0/s1 |
| InChIKey | NQPMRAZWCQBBGA-XSRQCEPYSA-N |
| XLogP | 1.89 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|