About 3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one
3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one (PubChem CID 57073820) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one |
| PubChem CID | 57073820 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1C1=CCC=CC1 |
| InChI | InChI=1S/C9H11NO2/c11-9-10(6-7-12-9)8-4-2-1-3-5-8/h1-2,5H,3-4,6-7H2 |
| InChIKey | GHLATGSDRZMRCZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one?
The IUPAC name of 3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one (CID 57073820) is 3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one?
The canonical SMILES for 3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one is O=C1OCCN1C1=CCC=CC1.
What is the InChIKey of 3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one?
The InChIKey is GHLATGSDRZMRCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c11-9-10(6-7-12-9)8-4-2-1-3-5-8/h1-2,5H,3-4,6-7H2.
What are the key properties of 3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one?
3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one has a molecular weight of 165.19 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,4-dien-1-yl-1,3-oxazolidin-2-one is sourced from PubChem (CID 57073820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).