About 5,5-dimethyltrioxane-4,6-dione
5,5-dimethyltrioxane-4,6-dione (PubChem CID 57073887) has the molecular formula C5H6O5
and a molecular weight of 146.10 g/mol. Its IUPAC name is 5,5-dimethyltrioxane-4,6-dione.
Molecular Properties
| Compound Name | 5,5-dimethyltrioxane-4,6-dione |
| PubChem CID | 57073887 |
| Molecular Formula | C5H6O5 |
| Molecular Weight | 146.10 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | 5,5-dimethyltrioxane-4,6-dione |
| SMILES | CC1(C)C(=O)OOOC1=O |
| InChI | InChI=1S/C5H6O5/c1-5(2)3(6)8-10-9-4(5)7/h1-2H3 |
| InChIKey | SFNUPTFTRXBUMR-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.10 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyltrioxane-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyltrioxane-4,6-dione?
The IUPAC name of 5,5-dimethyltrioxane-4,6-dione (CID 57073887) is 5,5-dimethyltrioxane-4,6-dione.
What is the SMILES notation for 5,5-dimethyltrioxane-4,6-dione?
The canonical SMILES for 5,5-dimethyltrioxane-4,6-dione is CC1(C)C(=O)OOOC1=O.
What is the InChIKey of 5,5-dimethyltrioxane-4,6-dione?
The InChIKey is SFNUPTFTRXBUMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O5/c1-5(2)3(6)8-10-9-4(5)7/h1-2H3.
What are the key properties of 5,5-dimethyltrioxane-4,6-dione?
5,5-dimethyltrioxane-4,6-dione has a molecular weight of 146.10 g/mol, XLogP of -0.04, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyltrioxane-4,6-dione is sourced from PubChem (CID 57073887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).