About 5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one
5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 57073990) has the molecular formula C14H11NO2S
and a molecular weight of 257.31 g/mol. Its IUPAC name is 5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one |
| PubChem CID | 57073990 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | C#Cc1cc(CC2SCNC2=O)cc(C#C)c1O |
| InChI | InChI=1S/C14H11NO2S/c1-3-10-5-9(6-11(4-2)13(10)16)7-12-14(17)15-8-18-12/h1-2,5-6,12,16H,7-8H2,(H,15,17) |
| InChIKey | XGFQKBJIYQPGAW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one?
The IUPAC name of 5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one (CID 57073990) is 5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one.
What is the SMILES notation for 5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one?
The canonical SMILES for 5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one is C#Cc1cc(CC2SCNC2=O)cc(C#C)c1O.
What is the InChIKey of 5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one?
The InChIKey is XGFQKBJIYQPGAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2S/c1-3-10-5-9(6-11(4-2)13(10)16)7-12-14(17)15-8-18-12/h1-2,5-6,12,16H,7-8H2,(H,15,17).
What are the key properties of 5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one?
5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one has a molecular weight of 257.31 g/mol, XLogP of 1.09, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-diethynyl-4-hydroxyphenyl)methyl]-1,3-thiazolidin-4-one is sourced from PubChem (CID 57073990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).