C15H28OSi — CID 57074355
trimethyl(6-propylnona-1,7,8-trien-4-yloxy)silane (PubChem CID 57074355) has the molecular formula C15H28OSi and a molecular weight of 252.47 g/mol. Its IUPAC name is trimethyl(6-propylnona-1,7,8-trien-4-yloxy)silane.
| Compound Name | trimethyl(6-propylnona-1,7,8-trien-4-yloxy)silane |
|---|---|
| PubChem CID | 57074355 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | trimethyl(6-propylnona-1,7,8-trien-4-yloxy)silane |
| SMILES | C=C=CC(CCC)CC(CC=C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H28OSi/c1-7-10-14(11-8-2)13-15(12-9-3)16-17(4,5)6/h9-10,14-15H,1,3,8,11-13H2,2,4-6H3 |
| InChIKey | BXFFASRRZSIJSE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|