C12H17FO7 — CID 57074984
1-[(2R,3S,4R,5R,6S)-4,6-diacetyl-5-fluoro-3,4,6-trihydroxy-2-methyloxan-3-yl]ethanone (PubChem CID 57074984) has the molecular formula C12H17FO7 and a molecular weight of 292.26 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R,6S)-4,6-diacetyl-5-fluoro-3,4,6-trihydroxy-2-methyloxan-3-yl]ethanone.
| Compound Name | 1-[(2R,3S,4R,5R,6S)-4,6-diacetyl-5-fluoro-3,4,6-trihydroxy-2-methyloxan-3-yl]ethanone |
|---|---|
| PubChem CID | 57074984 |
| Molecular Formula | C12H17FO7 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-[(2R,3S,4R,5R,6S)-4,6-diacetyl-5-fluoro-3,4,6-trihydroxy-2-methyloxan-3-yl]ethanone |
| SMILES | CC(=O)[C@]1(O)O[C@H](C)[C@@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@H]1F |
| InChI | InChI=1S/C12H17FO7/c1-5(14)10(17)8(4)20-12(19,7(3)16)9(13)11(10,18)6(2)15/h8-9,17-19H,1-4H3/t8-,9-,10+,11-,12+/m1/s1 |
| InChIKey | BGRIRZVXKQRTFZ-ZIQFBCGOSA-N |
| XLogP | -1.34 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |