About ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate
ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate (PubChem CID 57075358) has the molecular formula C21H21F2NO2
and a molecular weight of 357.40 g/mol. Its IUPAC name is ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate |
| PubChem CID | 57075358 |
| Molecular Formula | C21H21F2NO2 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C=C(c2ccc(F)cc2)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H21F2NO2/c1-2-26-21(25)24-12-11-15(14-24)13-20(16-3-7-18(22)8-4-16)17-5-9-19(23)10-6-17/h3-10,13,15H,2,11-12,14H2,1H3 |
| InChIKey | YRCKRBIEBWMZFW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate?
The IUPAC name of ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate (CID 57075358) is ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate?
The canonical SMILES for ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate is CCOC(=O)N1CCC(C=C(c2ccc(F)cc2)c2ccc(F)cc2)C1.
What is the InChIKey of ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate?
The InChIKey is YRCKRBIEBWMZFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F2NO2/c1-2-26-21(25)24-12-11-15(14-24)13-20(16-3-7-18(22)8-4-16)17-5-9-19(23)10-6-17/h3-10,13,15H,2,11-12,14H2,1H3.
What are the key properties of ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate?
ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate has a molecular weight of 357.40 g/mol, XLogP of 4.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2,2-bis(4-fluorophenyl)ethenyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 57075358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).