C27H39FO4 — CID 57075698
methyl 7-[(1S,4R,5S,6R)-4-(4-fluorophenyl)-6-(hexoxymethyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate (PubChem CID 57075698) has the molecular formula C27H39FO4 and a molecular weight of 446.60 g/mol. Its IUPAC name is methyl 7-[(1S,4R,5S,6R)-4-(4-fluorophenyl)-6-(hexoxymethyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate.
| Compound Name | methyl 7-[(1S,4R,5S,6R)-4-(4-fluorophenyl)-6-(hexoxymethyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 57075698 |
| Molecular Formula | C27H39FO4 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | methyl 7-[(1S,4R,5S,6R)-4-(4-fluorophenyl)-6-(hexoxymethyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
| SMILES | CCCCCCOC[C@@H]1[C@@H]2C[C@@](c3ccc(F)cc3)(CO2)[C@H]1CC=CCCCC(=O)OC |
| InChI | InChI=1S/C27H39FO4/c1-3-4-5-10-17-31-19-23-24(11-8-6-7-9-12-26(29)30-2)27(18-25(23)32-20-27)21-13-15-22(28)16-14-21/h6,8,13-16,23-25H,3-5,7,9-12,17-20H2,1-2H3/t23-,24-,25-,27-/m0/s1 |
| InChIKey | FYUXACCLIMRLOR-XLXZRNDBSA-N |
| XLogP | 5.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|