C16H20O4 — CID 57075710
3-(2,5-dimethyl-3,6-dioxo-4-prop-2-enylcyclohexa-1,4-dien-1-yl)-3-methylbutanoic acid (PubChem CID 57075710) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 3-(2,5-dimethyl-3,6-dioxo-4-prop-2-enylcyclohexa-1,4-dien-1-yl)-3-methylbutanoic acid.
| Compound Name | 3-(2,5-dimethyl-3,6-dioxo-4-prop-2-enylcyclohexa-1,4-dien-1-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 57075710 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 3-(2,5-dimethyl-3,6-dioxo-4-prop-2-enylcyclohexa-1,4-dien-1-yl)-3-methylbutanoic acid |
| SMILES | C=CCC1=C(C)C(=O)C(C(C)(C)CC(=O)O)=C(C)C1=O |
| InChI | InChI=1S/C16H20O4/c1-6-7-11-9(2)15(20)13(10(3)14(11)19)16(4,5)8-12(17)18/h6H,1,7-8H2,2-5H3,(H,17,18) |
| InChIKey | PQBHUKCMVNDCIT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|