About 4,5-dimethyl-2,3-dihydroisoindol-1-one
4,5-dimethyl-2,3-dihydroisoindol-1-one (PubChem CID 57076044) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 4,5-dimethyl-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 4,5-dimethyl-2,3-dihydroisoindol-1-one |
| PubChem CID | 57076044 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 4,5-dimethyl-2,3-dihydroisoindol-1-one |
| SMILES | Cc1ccc2c(c1C)CNC2=O |
| InChI | InChI=1S/C10H11NO/c1-6-3-4-8-9(7(6)2)5-11-10(8)12/h3-4H,5H2,1-2H3,(H,11,12) |
| InChIKey | JBOZOPBYMSDYAL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-dimethyl-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2,3-dihydroisoindol-1-one?
The IUPAC name of 4,5-dimethyl-2,3-dihydroisoindol-1-one (CID 57076044) is 4,5-dimethyl-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 4,5-dimethyl-2,3-dihydroisoindol-1-one?
The canonical SMILES for 4,5-dimethyl-2,3-dihydroisoindol-1-one is Cc1ccc2c(c1C)CNC2=O.
What is the InChIKey of 4,5-dimethyl-2,3-dihydroisoindol-1-one?
The InChIKey is JBOZOPBYMSDYAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-6-3-4-8-9(7(6)2)5-11-10(8)12/h3-4H,5H2,1-2H3,(H,11,12).
What are the key properties of 4,5-dimethyl-2,3-dihydroisoindol-1-one?
4,5-dimethyl-2,3-dihydroisoindol-1-one has a molecular weight of 161.20 g/mol, XLogP of 1.55, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 57076044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).