About 4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine
4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine (PubChem CID 57076313) has the molecular formula C6H5ClIN3
and a molecular weight of 281.48 g/mol. Its IUPAC name is 4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine |
| PubChem CID | 57076313 |
| Molecular Formula | C6H5ClIN3 |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 280.92 |
| IUPAC Name | 4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine |
| SMILES | ClC1c2cc[nH]c2N=CN1I |
| InChI | InChI=1S/C6H5ClIN3/c7-5-4-1-2-9-6(4)10-3-11(5)8/h1-3,5,9H |
| InChIKey | RNMJDKXYJXVRTK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 31.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine (CID 57076313) is 4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine is ClC1c2cc[nH]c2N=CN1I.
What is the InChIKey of 4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine?
The InChIKey is RNMJDKXYJXVRTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClIN3/c7-5-4-1-2-9-6(4)10-3-11(5)8/h1-3,5,9H.
What are the key properties of 4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine?
4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine has a molecular weight of 281.48 g/mol, XLogP of 2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-iodo-4,7-dihydropyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 57076313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).