C6H4F10O — CID 57076582
1,1,1,3,3-pentafluoro-3-(1,1,3,3,3-pentafluoropropoxy)propane (PubChem CID 57076582) has the molecular formula C6H4F10O and a molecular weight of 282.08 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-3-(1,1,3,3,3-pentafluoropropoxy)propane.
| Compound Name | 1,1,1,3,3-pentafluoro-3-(1,1,3,3,3-pentafluoropropoxy)propane |
|---|---|
| PubChem CID | 57076582 |
| Molecular Formula | C6H4F10O |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-3-(1,1,3,3,3-pentafluoropropoxy)propane |
| SMILES | FC(F)(F)CC(F)(F)OC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C6H4F10O/c7-3(8,9)1-5(13,14)17-6(15,16)2-4(10,11)12/h1-2H2 |
| InChIKey | LEEHHJCQFUKQTC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |