About 5,8a-dihydroindolizine-1,3,6-trione
5,8a-dihydroindolizine-1,3,6-trione (PubChem CID 57076682) has the molecular formula C8H7NO3
and a molecular weight of 165.15 g/mol. Its IUPAC name is 5,8a-dihydroindolizine-1,3,6-trione.
Molecular Properties
| Compound Name | 5,8a-dihydroindolizine-1,3,6-trione |
| PubChem CID | 57076682 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 5,8a-dihydroindolizine-1,3,6-trione |
| SMILES | O=C1C=CC2C(=O)CC(=O)N2C1 |
| InChI | InChI=1S/C8H7NO3/c10-5-1-2-6-7(11)3-8(12)9(6)4-5/h1-2,6H,3-4H2 |
| InChIKey | FWHSMCGYALZJIT-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5,8a-dihydroindolizine-1,3,6-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8a-dihydroindolizine-1,3,6-trione?
The IUPAC name of 5,8a-dihydroindolizine-1,3,6-trione (CID 57076682) is 5,8a-dihydroindolizine-1,3,6-trione.
What is the SMILES notation for 5,8a-dihydroindolizine-1,3,6-trione?
The canonical SMILES for 5,8a-dihydroindolizine-1,3,6-trione is O=C1C=CC2C(=O)CC(=O)N2C1.
What is the InChIKey of 5,8a-dihydroindolizine-1,3,6-trione?
The InChIKey is FWHSMCGYALZJIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3/c10-5-1-2-6-7(11)3-8(12)9(6)4-5/h1-2,6H,3-4H2.
What are the key properties of 5,8a-dihydroindolizine-1,3,6-trione?
5,8a-dihydroindolizine-1,3,6-trione has a molecular weight of 165.15 g/mol, XLogP of -0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8a-dihydroindolizine-1,3,6-trione is sourced from PubChem (CID 57076682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).