C15H21N3O3 — CID 57076895
1-hydroxy-1-[1-[3-(4-propan-2-ylphenyl)-2,5-dihydro-1,2-oxazol-4-yl]ethyl]urea (PubChem CID 57076895) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-hydroxy-1-[1-[3-(4-propan-2-ylphenyl)-2,5-dihydro-1,2-oxazol-4-yl]ethyl]urea.
| Compound Name | 1-hydroxy-1-[1-[3-(4-propan-2-ylphenyl)-2,5-dihydro-1,2-oxazol-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 57076895 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-hydroxy-1-[1-[3-(4-propan-2-ylphenyl)-2,5-dihydro-1,2-oxazol-4-yl]ethyl]urea |
| SMILES | CC(C)c1ccc(C2=C(C(C)N(O)C(N)=O)CON2)cc1 |
| InChI | InChI=1S/C15H21N3O3/c1-9(2)11-4-6-12(7-5-11)14-13(8-21-17-14)10(3)18(20)15(16)19/h4-7,9-10,17,20H,8H2,1-3H3,(H2,16,19) |
| InChIKey | PFWJURZGGJOGOT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|