About pyridine-2,5-dithione
pyridine-2,5-dithione (PubChem CID 57077106) has the molecular formula C5H3NS2
and a molecular weight of 141.22 g/mol. Its IUPAC name is pyridine-2,5-dithione.
Molecular Properties
| Compound Name | pyridine-2,5-dithione |
| PubChem CID | 57077106 |
| Molecular Formula | C5H3NS2 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 140.97 |
| IUPAC Name | pyridine-2,5-dithione |
| SMILES | S=C1C=CC(=S)N=C1 |
| InChI | InChI=1S/C5H3NS2/c7-4-1-2-5(8)6-3-4/h1-3H |
| InChIKey | YRLWVVOGIUXFJP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pyridine-2,5-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-2,5-dithione?
The IUPAC name of pyridine-2,5-dithione (CID 57077106) is pyridine-2,5-dithione.
What is the SMILES notation for pyridine-2,5-dithione?
The canonical SMILES for pyridine-2,5-dithione is S=C1C=CC(=S)N=C1.
What is the InChIKey of pyridine-2,5-dithione?
The InChIKey is YRLWVVOGIUXFJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3NS2/c7-4-1-2-5(8)6-3-4/h1-3H.
What are the key properties of pyridine-2,5-dithione?
pyridine-2,5-dithione has a molecular weight of 141.22 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-2,5-dithione is sourced from PubChem (CID 57077106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).