C12H27N3O3 — CID 57077875
1,3,5-tris(2-methoxyethyl)-1,3,5-triazinane (PubChem CID 57077875) has the molecular formula C12H27N3O3 and a molecular weight of 261.37 g/mol. Its IUPAC name is 1,3,5-tris(2-methoxyethyl)-1,3,5-triazinane.
| Compound Name | 1,3,5-tris(2-methoxyethyl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 57077875 |
| Molecular Formula | C12H27N3O3 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 1,3,5-tris(2-methoxyethyl)-1,3,5-triazinane |
| SMILES | COCCN1CN(CCOC)CN(CCOC)C1 |
| InChI | InChI=1S/C12H27N3O3/c1-16-7-4-13-10-14(5-8-17-2)12-15(11-13)6-9-18-3/h4-12H2,1-3H3 |
| InChIKey | FYBQUARQRSXEOP-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |