C26H33FO3S — CID 57078658
5-(4-fluorophenyl)sulfonyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-4-one (PubChem CID 57078658) has the molecular formula C26H33FO3S and a molecular weight of 444.61 g/mol. Its IUPAC name is 5-(4-fluorophenyl)sulfonyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-4-one.
| Compound Name | 5-(4-fluorophenyl)sulfonyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-4-one |
|---|---|
| PubChem CID | 57078658 |
| Molecular Formula | C26H33FO3S |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 5-(4-fluorophenyl)sulfonyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-4-one |
| SMILES | CC=C(C)C(=O)C(C=C(C)C=CC1=C(C)CCCC1(C)C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H33FO3S/c1-7-19(3)25(28)24(31(29,30)22-13-11-21(27)12-14-22)17-18(2)10-15-23-20(4)9-8-16-26(23,5)6/h7,10-15,17,24H,8-9,16H2,1-6H3 |
| InChIKey | IVIJGMGTLGRMNG-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|