C30H32N2O5 — CID 57078971
3,3,6,6-tetramethyl-9-(4-nitro-3-phenylmethoxyphenyl)-2,4,4a,5,7,8a-hexahydroacridine-1,8-dione (PubChem CID 57078971) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-9-(4-nitro-3-phenylmethoxyphenyl)-2,4,4a,5,7,8a-hexahydroacridine-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-9-(4-nitro-3-phenylmethoxyphenyl)-2,4,4a,5,7,8a-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 57078971 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 3,3,6,6-tetramethyl-9-(4-nitro-3-phenylmethoxyphenyl)-2,4,4a,5,7,8a-hexahydroacridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2C(=NC3CC(C)(C)CC(=O)C3=C2c2ccc([N+](=O)[O-])c(OCc3ccccc3)c2)C1 |
| InChI | InChI=1S/C30H32N2O5/c1-29(2)13-20-27(23(33)15-29)26(28-21(31-20)14-30(3,4)16-24(28)34)19-10-11-22(32(35)36)25(12-19)37-17-18-8-6-5-7-9-18/h5-12,20,28H,13-17H2,1-4H3 |
| InChIKey | BOEKKQDNXHUVRT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|