C28H31ClN2O3S2 — CID 57079096
5-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-9-(dimethylamino)-9-oxo-4,6-bis(sulfanyl)nonanoic acid (PubChem CID 57079096) has the molecular formula C28H31ClN2O3S2 and a molecular weight of 543.15 g/mol. Its IUPAC name is 5-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-9-(dimethylamino)-9-oxo-4,6-bis(sulfanyl)nonanoic acid.
| Compound Name | 5-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-9-(dimethylamino)-9-oxo-4,6-bis(sulfanyl)nonanoic acid |
|---|---|
| PubChem CID | 57079096 |
| Molecular Formula | C28H31ClN2O3S2 |
| Molecular Weight | 543.15 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 5-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-9-(dimethylamino)-9-oxo-4,6-bis(sulfanyl)nonanoic acid |
| SMILES | CN(C)C(=O)CCC(S)C(c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1)C(S)CCC(=O)O |
| InChI | InChI=1S/C28H31ClN2O3S2/c1-31(2)26(32)14-12-24(35)28(25(36)13-15-27(33)34)20-5-3-4-18(16-20)6-10-22-11-8-19-7-9-21(29)17-23(19)30-22/h3-11,16-17,24-25,28,35-36H,12-15H2,1-2H3,(H,33,34) |
| InChIKey | WMQCXTVBTVYCIZ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.15 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|