C21H41N3 — CID 57079103
5-octadec-9-enyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 57079103) has the molecular formula C21H41N3 and a molecular weight of 335.58 g/mol. Its IUPAC name is 5-octadec-9-enyl-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | 5-octadec-9-enyl-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 57079103 |
| Molecular Formula | C21H41N3 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.33 |
| IUPAC Name | 5-octadec-9-enyl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CCCCCCCCC=CCCCCCCCCC1CN=C(N)N1 |
| InChI | InChI=1S/C21H41N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-19-23-21(22)24-20/h9-10,20H,2-8,11-19H2,1H3,(H3,22,23,24) |
| InChIKey | IDRNODYNWIAJQI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|