C30H54 — CID 57079249
(4Z)-5,6,11-triethyl-12-methyl-13-prop-1-ynylicosa-4,8-diene (PubChem CID 57079249) has the molecular formula C30H54 and a molecular weight of 414.76 g/mol. Its IUPAC name is (4Z)-5,6,11-triethyl-12-methyl-13-prop-1-ynylicosa-4,8-diene.
| Compound Name | (4Z)-5,6,11-triethyl-12-methyl-13-prop-1-ynylicosa-4,8-diene |
|---|---|
| PubChem CID | 57079249 |
| Molecular Formula | C30H54 |
| Molecular Weight | 414.76 g/mol |
| Exact Mass | 414.42 |
| IUPAC Name | (4Z)-5,6,11-triethyl-12-methyl-13-prop-1-ynylicosa-4,8-diene |
| SMILES | CC#CC(CCCCCCC)C(C)C(CC)CC=CCC(CC)/C(=C\CCC)CC |
| InChI | InChI=1S/C30H54/c1-8-14-16-17-18-25-30(21-10-3)26(7)27(11-4)23-19-20-24-29(13-6)28(12-5)22-15-9-2/h19-20,22,26-27,29-30H,8-9,11-18,23-25H2,1-7H3/b20-19?,28-22- |
| InChIKey | IFTGQWMCLVYVOV-WQEQWUHUSA-N |
| XLogP | 10.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.76 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|