C29H39NO — CID 57079451
(3R,5R,10R,13R,14R,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-1-phenylpropan-2-yl]-1,2,3,4,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-5-carbonitrile (PubChem CID 57079451) has the molecular formula C29H39NO and a molecular weight of 417.64 g/mol. Its IUPAC name is (3R,5R,10R,13R,14R,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-1-phenylpropan-2-yl]-1,2,3,4,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-5-carbonitrile.
| Compound Name | (3R,5R,10R,13R,14R,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-1-phenylpropan-2-yl]-1,2,3,4,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-5-carbonitrile |
|---|---|
| PubChem CID | 57079451 |
| Molecular Formula | C29H39NO |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | (3R,5R,10R,13R,14R,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-1-phenylpropan-2-yl]-1,2,3,4,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-5-carbonitrile |
| SMILES | C[C@H](Cc1ccccc1)[C@H]1CC[C@H]2C3=C(CC[C@]12C)[C@@]1(C)CC[C@@H](O)C[C@]1(C#N)CC3 |
| InChI | InChI=1S/C29H39NO/c1-20(17-21-7-5-4-6-8-21)24-9-10-25-23-12-16-29(19-30)18-22(31)11-15-28(29,3)26(23)13-14-27(24,25)2/h4-8,20,22,24-25,31H,9-18H2,1-3H3/t20-,22-,24-,25+,27-,28-,29+/m1/s1 |
| InChIKey | NYPLXULNTOHXNJ-KGFRTOJSSA-N |
| XLogP | 6.84 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|