C22H38Br2OSi — CID 57079476
[(1S,4aS,8aR)-5-[(2R)-5,5-dibromopent-4-en-2-yl]-4a-methyl-2,3,4,7,8,8a-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 57079476) has the molecular formula C22H38Br2OSi and a molecular weight of 506.44 g/mol. Its IUPAC name is [(1S,4aS,8aR)-5-[(2R)-5,5-dibromopent-4-en-2-yl]-4a-methyl-2,3,4,7,8,8a-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,4aS,8aR)-5-[(2R)-5,5-dibromopent-4-en-2-yl]-4a-methyl-2,3,4,7,8,8a-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 57079476 |
| Molecular Formula | C22H38Br2OSi |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | [(1S,4aS,8aR)-5-[(2R)-5,5-dibromopent-4-en-2-yl]-4a-methyl-2,3,4,7,8,8a-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H](CC=C(Br)Br)C1=CCC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C22H38Br2OSi/c1-16(13-14-20(23)24)17-10-8-11-18-19(12-9-15-22(17,18)5)25-26(6,7)21(2,3)4/h10,14,16,18-19H,8-9,11-13,15H2,1-7H3/t16-,18+,19+,22-/m1/s1 |
| InChIKey | KJALSFMEHKEPFE-PGVBMLAISA-N |
| XLogP | 8.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|