C25H31N5O6S — CID 57079735
[[3-hydroxy-6-(hydroxyamino)-5-(1-hydroxy-4-methylcyclohexyl)-6-oxo-1-(1,3-thiazol-4-yl)hexan-2-yl]amino] quinoxaline-2-carboxylate (PubChem CID 57079735) has the molecular formula C25H31N5O6S and a molecular weight of 529.62 g/mol. Its IUPAC name is [[3-hydroxy-6-(hydroxyamino)-5-(1-hydroxy-4-methylcyclohexyl)-6-oxo-1-(1,3-thiazol-4-yl)hexan-2-yl]amino] quinoxaline-2-carboxylate.
| Compound Name | [[3-hydroxy-6-(hydroxyamino)-5-(1-hydroxy-4-methylcyclohexyl)-6-oxo-1-(1,3-thiazol-4-yl)hexan-2-yl]amino] quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 57079735 |
| Molecular Formula | C25H31N5O6S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | [[3-hydroxy-6-(hydroxyamino)-5-(1-hydroxy-4-methylcyclohexyl)-6-oxo-1-(1,3-thiazol-4-yl)hexan-2-yl]amino] quinoxaline-2-carboxylate |
| SMILES | CC1CCC(O)(C(CC(O)C(Cc2cscn2)NOC(=O)c2cnc3ccccc3n2)C(=O)NO)CC1 |
| InChI | InChI=1S/C25H31N5O6S/c1-15-6-8-25(34,9-7-15)17(23(32)29-35)11-22(31)20(10-16-13-37-14-27-16)30-36-24(33)21-12-26-18-4-2-3-5-19(18)28-21/h2-5,12-15,17,20,22,30-31,34-35H,6-11H2,1H3,(H,29,32) |
| InChIKey | SHPKTKVNPADZMY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 166.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|