About indazol-1-yl formate
indazol-1-yl formate (PubChem CID 57079920) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is indazol-1-yl formate.
Molecular Properties
| Compound Name | indazol-1-yl formate |
| PubChem CID | 57079920 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | indazol-1-yl formate |
| SMILES | O=COn1ncc2ccccc21 |
| InChI | InChI=1S/C8H6N2O2/c11-6-12-10-8-4-2-1-3-7(8)5-9-10/h1-6H |
| InChIKey | DPQJFLGVRMTJQE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze indazol-1-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indazol-1-yl formate?
The IUPAC name of indazol-1-yl formate (CID 57079920) is indazol-1-yl formate.
What is the SMILES notation for indazol-1-yl formate?
The canonical SMILES for indazol-1-yl formate is O=COn1ncc2ccccc21.
What is the InChIKey of indazol-1-yl formate?
The InChIKey is DPQJFLGVRMTJQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c11-6-12-10-8-4-2-1-3-7(8)5-9-10/h1-6H.
What are the key properties of indazol-1-yl formate?
indazol-1-yl formate has a molecular weight of 162.15 g/mol, XLogP of 0.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for indazol-1-yl formate is sourced from PubChem (CID 57079920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).