C18H22ClN9O4 — CID 57080169
methyl 4-[[(N'-carbamoylcarbamimidoyl)-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]amino]methyl]benzoate (PubChem CID 57080169) has the molecular formula C18H22ClN9O4 and a molecular weight of 463.89 g/mol. Its IUPAC name is methyl 4-[[(N'-carbamoylcarbamimidoyl)-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[(N'-carbamoylcarbamimidoyl)-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 57080169 |
| Molecular Formula | C18H22ClN9O4 |
| Molecular Weight | 463.89 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | methyl 4-[[(N'-carbamoylcarbamimidoyl)-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(CCNC(=O)c2nc(Cl)c(N)nc2N)C(N)=NC(N)=O)cc1 |
| InChI | InChI=1S/C18H22ClN9O4/c1-32-16(30)10-4-2-9(3-5-10)8-28(17(22)27-18(23)31)7-6-24-15(29)11-13(20)26-14(21)12(19)25-11/h2-5H,6-8H2,1H3,(H,24,29)(H4,20,21,26)(H4,22,23,27,31) |
| InChIKey | VQOANAJJFJYJBN-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 217.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.89 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|