C20H42N2 — CID 57080271
1-cyclopentyl-10-methyltetradecane-1,10-diamine (PubChem CID 57080271) has the molecular formula C20H42N2 and a molecular weight of 310.57 g/mol. Its IUPAC name is 1-cyclopentyl-10-methyltetradecane-1,10-diamine.
| Compound Name | 1-cyclopentyl-10-methyltetradecane-1,10-diamine |
|---|---|
| PubChem CID | 57080271 |
| Molecular Formula | C20H42N2 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.33 |
| IUPAC Name | 1-cyclopentyl-10-methyltetradecane-1,10-diamine |
| SMILES | CCCCC(C)(N)CCCCCCCCC(N)C1CCCC1 |
| InChI | InChI=1S/C20H42N2/c1-3-4-16-20(2,22)17-12-8-6-5-7-9-15-19(21)18-13-10-11-14-18/h18-19H,3-17,21-22H2,1-2H3 |
| InChIKey | UQHXJBOEHKIBFT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|