About 6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one
6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one (PubChem CID 57080956) has the molecular formula C7H10N4O2
and a molecular weight of 182.18 g/mol. Its IUPAC name is 6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one.
Molecular Properties
| Compound Name | 6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one |
| PubChem CID | 57080956 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one |
| SMILES | CN1C(=O)N(C)C2N=CNC2=C1O |
| InChI | InChI=1S/C7H10N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3,5,12H,1-2H3,(H,8,9) |
| InChIKey | MZNJSAJWGUPRKQ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one?
The IUPAC name of 6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one (CID 57080956) is 6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one.
What is the SMILES notation for 6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one?
The canonical SMILES for 6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one is CN1C(=O)N(C)C2N=CNC2=C1O.
What is the InChIKey of 6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one?
The InChIKey is MZNJSAJWGUPRKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3,5,12H,1-2H3,(H,8,9).
What are the key properties of 6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one?
6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one has a molecular weight of 182.18 g/mol, XLogP of -0.33, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-1,3-dimethyl-4,7-dihydropurin-2-one is sourced from PubChem (CID 57080956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).