C32H48N2O4 — CID 57081345
3,5-ditert-butyl-N'-[2-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]-4-hydroxybenzohydrazide (PubChem CID 57081345) has the molecular formula C32H48N2O4 and a molecular weight of 524.75 g/mol. Its IUPAC name is 3,5-ditert-butyl-N'-[2-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]-4-hydroxybenzohydrazide.
| Compound Name | 3,5-ditert-butyl-N'-[2-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]-4-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 57081345 |
| Molecular Formula | C32H48N2O4 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | 3,5-ditert-butyl-N'-[2-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]-4-hydroxybenzohydrazide |
| SMILES | CC(C(=O)NNC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H48N2O4/c1-18(19-14-21(29(2,3)4)25(35)22(15-19)30(5,6)7)27(37)33-34-28(38)20-16-23(31(8,9)10)26(36)24(17-20)32(11,12)13/h14-18,35-36H,1-13H3,(H,33,37)(H,34,38) |
| InChIKey | VIEUYRDGUMNGIL-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|