About 4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one
4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one (PubChem CID 57081384) has the molecular formula C6H12O2S2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one |
| PubChem CID | 57081384 |
| Molecular Formula | C6H12O2S2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one |
| SMILES | CC(=O)CC(CO)C(S)S |
| InChI | InChI=1S/C6H12O2S2/c1-4(8)2-5(3-7)6(9)10/h5-7,9-10H,2-3H2,1H3 |
| InChIKey | JRBGTACIQCUTOO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one?
The IUPAC name of 4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one (CID 57081384) is 4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one.
What is the SMILES notation for 4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one?
The canonical SMILES for 4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one is CC(=O)CC(CO)C(S)S.
What is the InChIKey of 4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one?
The InChIKey is JRBGTACIQCUTOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2S2/c1-4(8)2-5(3-7)6(9)10/h5-7,9-10H,2-3H2,1H3.
What are the key properties of 4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one?
4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one has a molecular weight of 180.29 g/mol, XLogP of 0.76, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-5,5-bis(sulfanyl)pentan-2-one is sourced from PubChem (CID 57081384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).