C18H25NO3S — CID 57081481
tert-butyl (3S,6R,8aR)-5-oxo-6-(thiophen-2-ylmethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizine-3-carboxylate (PubChem CID 57081481) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is tert-butyl (3S,6R,8aR)-5-oxo-6-(thiophen-2-ylmethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizine-3-carboxylate.
| Compound Name | tert-butyl (3S,6R,8aR)-5-oxo-6-(thiophen-2-ylmethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizine-3-carboxylate |
|---|---|
| PubChem CID | 57081481 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | tert-butyl (3S,6R,8aR)-5-oxo-6-(thiophen-2-ylmethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CC[C@H]2CC[C@H](Cc3cccs3)C(=O)N21 |
| InChI | InChI=1S/C18H25NO3S/c1-18(2,3)22-17(21)15-9-8-13-7-6-12(16(20)19(13)15)11-14-5-4-10-23-14/h4-5,10,12-13,15H,6-9,11H2,1-3H3/t12-,13-,15+/m1/s1 |
| InChIKey | NOUPKRXSYONEAF-NFAWXSAZSA-N |
| XLogP | 3.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |