C11H12Cl4N2O5 — CID 57081642
2-[(2R,3S)-2-chloro-4-oxo-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]-3-methylbut-2-enoic acid (PubChem CID 57081642) has the molecular formula C11H12Cl4N2O5 and a molecular weight of 394.04 g/mol. Its IUPAC name is 2-[(2R,3S)-2-chloro-4-oxo-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]-3-methylbut-2-enoic acid.
| Compound Name | 2-[(2R,3S)-2-chloro-4-oxo-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 57081642 |
| Molecular Formula | C11H12Cl4N2O5 |
| Molecular Weight | 394.04 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | 2-[(2R,3S)-2-chloro-4-oxo-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]-3-methylbut-2-enoic acid |
| SMILES | CC(C)=C(C(=O)O)N1C(=O)[C@H](NC(=O)OCC(Cl)(Cl)Cl)[C@H]1Cl |
| InChI | InChI=1S/C11H12Cl4N2O5/c1-4(2)6(9(19)20)17-7(12)5(8(17)18)16-10(21)22-3-11(13,14)15/h5,7H,3H2,1-2H3,(H,16,21)(H,19,20)/t5-,7+/m1/s1 |
| InChIKey | KRAJGMXCOYLZFI-VDTYLAMSSA-N |
| XLogP | 2.24 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.04 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|