C9H13FO — CID 57081783
6-fluoronona-5,7,8-trien-1-ol (PubChem CID 57081783) has the molecular formula C9H13FO and a molecular weight of 156.20 g/mol. Its IUPAC name is 6-fluoronona-5,7,8-trien-1-ol.
| Compound Name | 6-fluoronona-5,7,8-trien-1-ol |
|---|---|
| PubChem CID | 57081783 |
| Molecular Formula | C9H13FO |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 6-fluoronona-5,7,8-trien-1-ol |
| SMILES | C=C=CC(F)=CCCCCO |
| InChI | InChI=1S/C9H13FO/c1-2-6-9(10)7-4-3-5-8-11/h6-7,11H,1,3-5,8H2 |
| InChIKey | BQERKOVHLXYREA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|