C13H10O6S — CID 57081801
6-methylsulfonylnaphthalene-1,4-dicarboxylic acid (PubChem CID 57081801) has the molecular formula C13H10O6S and a molecular weight of 294.28 g/mol. Its IUPAC name is 6-methylsulfonylnaphthalene-1,4-dicarboxylic acid.
| Compound Name | 6-methylsulfonylnaphthalene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 57081801 |
| Molecular Formula | C13H10O6S |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 6-methylsulfonylnaphthalene-1,4-dicarboxylic acid |
| SMILES | CS(=O)(=O)c1ccc2c(C(=O)O)ccc(C(=O)O)c2c1 |
| InChI | InChI=1S/C13H10O6S/c1-20(18,19)7-2-3-8-9(12(14)15)4-5-10(13(16)17)11(8)6-7/h2-6H,1H3,(H,14,15)(H,16,17) |
| InChIKey | GVFWUVBUOBKGLW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |