About 5-but-3-yn-2-yl-1,3-oxazole
5-but-3-yn-2-yl-1,3-oxazole (PubChem CID 57081905) has the molecular formula C7H7NO
and a molecular weight of 121.14 g/mol. Its IUPAC name is 5-but-3-yn-2-yl-1,3-oxazole.
Molecular Properties
| Compound Name | 5-but-3-yn-2-yl-1,3-oxazole |
| PubChem CID | 57081905 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | 5-but-3-yn-2-yl-1,3-oxazole |
| SMILES | C#CC(C)c1cnco1 |
| InChI | InChI=1S/C7H7NO/c1-3-6(2)7-4-8-5-9-7/h1,4-6H,2H3 |
| InChIKey | DYOFGSWXMSPCGU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-but-3-yn-2-yl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-3-yn-2-yl-1,3-oxazole?
The IUPAC name of 5-but-3-yn-2-yl-1,3-oxazole (CID 57081905) is 5-but-3-yn-2-yl-1,3-oxazole.
What is the SMILES notation for 5-but-3-yn-2-yl-1,3-oxazole?
The canonical SMILES for 5-but-3-yn-2-yl-1,3-oxazole is C#CC(C)c1cnco1.
What is the InChIKey of 5-but-3-yn-2-yl-1,3-oxazole?
The InChIKey is DYOFGSWXMSPCGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO/c1-3-6(2)7-4-8-5-9-7/h1,4-6H,2H3.
What are the key properties of 5-but-3-yn-2-yl-1,3-oxazole?
5-but-3-yn-2-yl-1,3-oxazole has a molecular weight of 121.14 g/mol, XLogP of 1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-3-yn-2-yl-1,3-oxazole is sourced from PubChem (CID 57081905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).