C22H34O4 — CID 57081995
5-[(3aR,5R,6R,6aR)-6-(3-cyclohexylpropanoyl)-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid (PubChem CID 57081995) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 5-[(3aR,5R,6R,6aR)-6-(3-cyclohexylpropanoyl)-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid.
| Compound Name | 5-[(3aR,5R,6R,6aR)-6-(3-cyclohexylpropanoyl)-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 57081995 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 5-[(3aR,5R,6R,6aR)-6-(3-cyclohexylpropanoyl)-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCC1=C[C@@H]2C[C@@H](O)[C@H](C(=O)CCC3CCCCC3)[C@@H]2C1 |
| InChI | InChI=1S/C22H34O4/c23-19(11-10-15-6-2-1-3-7-15)22-18-13-16(8-4-5-9-21(25)26)12-17(18)14-20(22)24/h12,15,17-18,20,22,24H,1-11,13-14H2,(H,25,26)/t17-,18-,20-,22+/m1/s1 |
| InChIKey | ZQDKOUFSFPPDLQ-DBQGFPOUSA-N |
| XLogP | 4.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|