About cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate
cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate (PubChem CID 57082039) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate |
| PubChem CID | 57082039 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate |
| SMILES | CC(=O)C=C[C@@H]1[C@@H](C(=O)OC(C)(C)C)C1(C)C |
| InChI | InChI=1S/C14H22O3/c1-9(15)7-8-10-11(14(10,5)6)12(16)17-13(2,3)4/h7-8,10-11H,1-6H3/t10-,11+/m1/s1 |
| InChIKey | OLLJMSYTZWBSTH-MNOVXSKESA-N |
| XLogP | 2.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate?
The IUPAC name of cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate (CID 57082039) is cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate.
What is the SMILES notation for cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate?
The canonical SMILES for cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate is CC(=O)C=C[C@@H]1[C@@H](C(=O)OC(C)(C)C)C1(C)C.
What is the InChIKey of cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate?
The InChIKey is OLLJMSYTZWBSTH-MNOVXSKESA-N. The full InChI is InChI=1S/C14H22O3/c1-9(15)7-8-10-11(14(10,5)6)12(16)17-13(2,3)4/h7-8,10-11H,1-6H3/t10-,11+/m1/s1.
What are the key properties of cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate?
cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate has a molecular weight of 238.33 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-tert-butyl (1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 57082039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).