C25H27F3N4O8 — CID 57082536
(4S,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(2,2,2-trifluoroacetyl)amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 57082536) has the molecular formula C25H27F3N4O8 and a molecular weight of 568.51 g/mol. Its IUPAC name is (4S,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(2,2,2-trifluoroacetyl)amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(2,2,2-trifluoroacetyl)amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 57082536 |
| Molecular Formula | C25H27F3N4O8 |
| Molecular Weight | 568.51 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | (4S,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(2,2,2-trifluoroacetyl)amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)C(F)(F)F)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C25H27F3N4O8/c1-31(2)12-7-11(30-23(39)25(26,27)28)17(33)14-9(12)5-8-6-10-16(32(3)4)19(35)15(22(29)38)21(37)24(10,40)20(36)13(8)18(14)34/h7-8,10,13,15-16,33,40H,5-6H2,1-4H3,(H2,29,38)(H,30,39)/t8?,10?,13?,15?,16-,24-/m0/s1 |
| InChIKey | XTYVFAQAWWXXEW-QTJFCSTCSA-N |
| XLogP | -0.57 |
| TPSA | 187.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.51 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|