C16H18O5 — CID 57082676
1-[2-[2-(1,2-dihydroxyethyl)phenoxy]phenyl]ethane-1,2-diol (PubChem CID 57082676) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is 1-[2-[2-(1,2-dihydroxyethyl)phenoxy]phenyl]ethane-1,2-diol.
| Compound Name | 1-[2-[2-(1,2-dihydroxyethyl)phenoxy]phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 57082676 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-[2-[2-(1,2-dihydroxyethyl)phenoxy]phenyl]ethane-1,2-diol |
| SMILES | OCC(O)c1ccccc1Oc1ccccc1C(O)CO |
| InChI | InChI=1S/C16H18O5/c17-9-13(19)11-5-1-3-7-15(11)21-16-8-4-2-6-12(16)14(20)10-18/h1-8,13-14,17-20H,9-10H2 |
| InChIKey | XEFDRFPVXWTVJE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |