About [1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid
[1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid (PubChem CID 57083327) has the molecular formula C11H19BN2O3
and a molecular weight of 238.10 g/mol. Its IUPAC name is [1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid.
Molecular Properties
| Compound Name | [1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid |
| PubChem CID | 57083327 |
| Molecular Formula | C11H19BN2O3 |
| Molecular Weight | 238.10 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | [1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid |
| SMILES | N[C@H]1CC=CC[C@@H]1C(=O)N1CCCC1B(O)O |
| InChI | InChI=1S/C11H19BN2O3/c13-9-5-2-1-4-8(9)11(15)14-7-3-6-10(14)12(16)17/h1-2,8-10,16-17H,3-7,13H2/t8-,9-,10?/m0/s1 |
| InChIKey | SMODZDWDAYGSIG-XMCUXHSSSA-N |
| XLogP | -0.72 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.10 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid?
The IUPAC name of [1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid (CID 57083327) is [1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid.
What is the SMILES notation for [1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid?
The canonical SMILES for [1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid is N[C@H]1CC=CC[C@@H]1C(=O)N1CCCC1B(O)O.
What is the InChIKey of [1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid?
The InChIKey is SMODZDWDAYGSIG-XMCUXHSSSA-N. The full InChI is InChI=1S/C11H19BN2O3/c13-9-5-2-1-4-8(9)11(15)14-7-3-6-10(14)12(16)17/h1-2,8-10,16-17H,3-7,13H2/t8-,9-,10?/m0/s1.
What are the key properties of [1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid?
[1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid has a molecular weight of 238.10 g/mol, XLogP of -0.72, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1S,6S)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid is sourced from PubChem (CID 57083327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).