C9H19N3O2 — CID 57083362
(1Z,3E)-4-N-ethoxy-1-N-methoxy-2-N,2-N-dimethylbuta-1,3-diene-1,2,4-triamine (PubChem CID 57083362) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is (1Z,3E)-4-N-ethoxy-1-N-methoxy-2-N,2-N-dimethylbuta-1,3-diene-1,2,4-triamine.
| Compound Name | (1Z,3E)-4-N-ethoxy-1-N-methoxy-2-N,2-N-dimethylbuta-1,3-diene-1,2,4-triamine |
|---|---|
| PubChem CID | 57083362 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (1Z,3E)-4-N-ethoxy-1-N-methoxy-2-N,2-N-dimethylbuta-1,3-diene-1,2,4-triamine |
| SMILES | CCON/C=C/C(=C/NOC)N(C)C |
| InChI | InChI=1S/C9H19N3O2/c1-5-14-10-7-6-9(12(2)3)8-11-13-4/h6-8,10-11H,5H2,1-4H3/b7-6+,9-8- |
| InChIKey | AKTHYRODFDEELT-MUIOLIGRSA-N |
| XLogP | 0.60 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|