C15H30N2O3 — CID 57083781
2-methyl-4-[2-[1-(3-methylmorpholin-4-yl)propan-2-yloxy]ethyl]morpholine (PubChem CID 57083781) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-methyl-4-[2-[1-(3-methylmorpholin-4-yl)propan-2-yloxy]ethyl]morpholine.
| Compound Name | 2-methyl-4-[2-[1-(3-methylmorpholin-4-yl)propan-2-yloxy]ethyl]morpholine |
|---|---|
| PubChem CID | 57083781 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 2-methyl-4-[2-[1-(3-methylmorpholin-4-yl)propan-2-yloxy]ethyl]morpholine |
| SMILES | CC1CN(CCOC(C)CN2CCOCC2C)CCO1 |
| InChI | InChI=1S/C15H30N2O3/c1-13-12-18-7-6-17(13)11-15(3)20-9-5-16-4-8-19-14(2)10-16/h13-15H,4-12H2,1-3H3 |
| InChIKey | UFMNRYBPRFGHNI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |