C26H50N4O2 — CID 57083811
N-[6-[formyl-(2,2,6,6-tetramethylpiperidin-1-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-1-yl)formamide (PubChem CID 57083811) has the molecular formula C26H50N4O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is N-[6-[formyl-(2,2,6,6-tetramethylpiperidin-1-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-1-yl)formamide.
| Compound Name | N-[6-[formyl-(2,2,6,6-tetramethylpiperidin-1-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-1-yl)formamide |
|---|---|
| PubChem CID | 57083811 |
| Molecular Formula | C26H50N4O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.39 |
| IUPAC Name | N-[6-[formyl-(2,2,6,6-tetramethylpiperidin-1-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-1-yl)formamide |
| SMILES | CC1(C)CCCC(C)(C)N1N(C=O)CCCCCCN(C=O)N1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C26H50N4O2/c1-23(2)15-13-16-24(3,4)29(23)27(21-31)19-11-9-10-12-20-28(22-32)30-25(5,6)17-14-18-26(30,7)8/h21-22H,9-20H2,1-8H3 |
| InChIKey | UZBOXUKPACYXBQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|