C9H14N4O2S2 — CID 57083920
2-[2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]hydrazinyl]-2-sulfanylideneacetic acid (PubChem CID 57083920) has the molecular formula C9H14N4O2S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-[2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]hydrazinyl]-2-sulfanylideneacetic acid.
| Compound Name | 2-[2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]hydrazinyl]-2-sulfanylideneacetic acid |
|---|---|
| PubChem CID | 57083920 |
| Molecular Formula | C9H14N4O2S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-[2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]hydrazinyl]-2-sulfanylideneacetic acid |
| SMILES | Cc1[nH]cnc1CSCCNNC(=S)C(=O)O |
| InChI | InChI=1S/C9H14N4O2S2/c1-6-7(11-5-10-6)4-17-3-2-12-13-8(16)9(14)15/h5,12H,2-4H2,1H3,(H,10,11)(H,13,16)(H,14,15) |
| InChIKey | SHZDJVDJLOGPDV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|