C39H37N9O2 — CID 57083928
ethyl 2-[[1-benzyl-4-[(1-benzylindazol-4-yl)amino]-5-ethyl-3aH-indazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate (PubChem CID 57083928) has the molecular formula C39H37N9O2 and a molecular weight of 663.79 g/mol. Its IUPAC name is ethyl 2-[[1-benzyl-4-[(1-benzylindazol-4-yl)amino]-5-ethyl-3aH-indazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate.
| Compound Name | ethyl 2-[[1-benzyl-4-[(1-benzylindazol-4-yl)amino]-5-ethyl-3aH-indazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
|---|---|
| PubChem CID | 57083928 |
| Molecular Formula | C39H37N9O2 |
| Molecular Weight | 663.79 g/mol |
| Exact Mass | 663.31 |
| IUPAC Name | ethyl 2-[[1-benzyl-4-[(1-benzylindazol-4-yl)amino]-5-ethyl-3aH-indazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
| SMILES | CCOC(=O)c1cc2cnc(NC3(Nc4cccc5c4cnn5Cc4ccccc4)C(CC)=CC=C4C3C=NN4Cc3ccccc3)nn2c1 |
| InChI | InChI=1S/C39H37N9O2/c1-3-30-18-19-36-33(23-42-48(36)25-28-14-9-6-10-15-28)39(30,44-38-40-21-31-20-29(26-46(31)45-38)37(49)50-4-2)43-34-16-11-17-35-32(34)22-41-47(35)24-27-12-7-5-8-13-27/h5-23,26,33,43H,3-4,24-25H2,1-2H3,(H,44,45) |
| InChIKey | BLNCWEQLIRBMGF-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.79 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|