C15H17N3O4S — CID 57084280
(5R,6S)-3-[(4-aminoanilino)methyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 57084280) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is (5R,6S)-3-[(4-aminoanilino)methyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-3-[(4-aminoanilino)methyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57084280 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (5R,6S)-3-[(4-aminoanilino)methyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(CNc3ccc(N)cc3)S[C@H]12 |
| InChI | InChI=1S/C15H17N3O4S/c1-7(19)11-13(20)18-12(15(21)22)10(23-14(11)18)6-17-9-4-2-8(16)3-5-9/h2-5,7,11,14,17,19H,6,16H2,1H3,(H,21,22)/t7-,11+,14-/m1/s1 |
| InChIKey | QBSUSBGPOGVHFF-PHPRGHSWSA-N |
| XLogP | 0.89 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|