About 1,4,21,23-tetrahydroporphyrin
1,4,21,23-tetrahydroporphyrin (PubChem CID 57084381) has the molecular formula C20H16N4
and a molecular weight of 312.38 g/mol. Its IUPAC name is 1,4,21,23-tetrahydroporphyrin.
Molecular Properties
| Compound Name | 1,4,21,23-tetrahydroporphyrin |
| PubChem CID | 57084381 |
| Molecular Formula | C20H16N4 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1,4,21,23-tetrahydroporphyrin |
| SMILES | C1=CC2=NC1=CC1C=CC(C=C3C=CC(=N3)C=c3ccc([nH]3)=C2)N1 |
| InChI | InChI=1S/C20H16N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-14,21,24H |
| InChIKey | KUOZVJWNLHXSAA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,4,21,23-tetrahydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,21,23-tetrahydroporphyrin?
The IUPAC name of 1,4,21,23-tetrahydroporphyrin (CID 57084381) is 1,4,21,23-tetrahydroporphyrin.
What is the SMILES notation for 1,4,21,23-tetrahydroporphyrin?
The canonical SMILES for 1,4,21,23-tetrahydroporphyrin is C1=CC2=NC1=CC1C=CC(C=C3C=CC(=N3)C=c3ccc([nH]3)=C2)N1.
What is the InChIKey of 1,4,21,23-tetrahydroporphyrin?
The InChIKey is KUOZVJWNLHXSAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-14,21,24H.
What are the key properties of 1,4,21,23-tetrahydroporphyrin?
1,4,21,23-tetrahydroporphyrin has a molecular weight of 312.38 g/mol, XLogP of 1.28, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,21,23-tetrahydroporphyrin is sourced from PubChem (CID 57084381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).