C22H34O3 — CID 57084641
(1S,2S,3R,6S)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-7-(5-hydroxypentylidene)bicyclo[4.2.0]octan-3-ol (PubChem CID 57084641) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (1S,2S,3R,6S)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-7-(5-hydroxypentylidene)bicyclo[4.2.0]octan-3-ol.
| Compound Name | (1S,2S,3R,6S)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-7-(5-hydroxypentylidene)bicyclo[4.2.0]octan-3-ol |
|---|---|
| PubChem CID | 57084641 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (1S,2S,3R,6S)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-7-(5-hydroxypentylidene)bicyclo[4.2.0]octan-3-ol |
| SMILES | OCCCCC=C1C[C@@H]2[C@@H](C#CC(O)C3CCCCC3)[C@H](O)CC[C@H]12 |
| InChI | InChI=1S/C22H34O3/c23-14-6-2-5-9-17-15-20-18(17)10-13-22(25)19(20)11-12-21(24)16-7-3-1-4-8-16/h9,16,18-25H,1-8,10,13-15H2/t18-,19-,20+,21?,22-/m1/s1 |
| InChIKey | CQRLHHPXZXGOOO-ZHXVYXOISA-N |
| XLogP | 3.43 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|